C48H64P2S2 — CID 23421786
[2,3-dithiophen-2-yl-4-(2,4,6-tritert-butylphenyl)phosphanylidenebuta-1,3-dienylidene]-(2,4,6-tritert-butylphenyl)phosphane (PubChem CID 23421786) has the molecular formula C48H64P2S2 and a molecular weight of 767.12 g/mol. Its IUPAC name is [2,3-dithiophen-2-yl-4-(2,4,6-tritert-butylphenyl)phosphanylidenebuta-1,3-dienylidene]-(2,4,6-tritert-butylphenyl)phosphane.
| Compound Name | [2,3-dithiophen-2-yl-4-(2,4,6-tritert-butylphenyl)phosphanylidenebuta-1,3-dienylidene]-(2,4,6-tritert-butylphenyl)phosphane |
|---|---|
| PubChem CID | 23421786 |
| Molecular Formula | C48H64P2S2 |
| Molecular Weight | 767.12 g/mol |
| Exact Mass | 766.39 |
| IUPAC Name | [2,3-dithiophen-2-yl-4-(2,4,6-tritert-butylphenyl)phosphanylidenebuta-1,3-dienylidene]-(2,4,6-tritert-butylphenyl)phosphane |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c(P=C=C(C(=C=Pc2c(C(C)(C)C)cc(C(C)(C)C)cc2C(C)(C)C)c2cccs2)c2cccs2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C48H64P2S2/c1-43(2,3)31-25-35(45(7,8)9)41(36(26-31)46(10,11)12)49-29-33(39-21-19-23-51-39)34(40-22-20-24-52-40)30-50-42-37(47(13,14)15)27-32(44(4,5)6)28-38(42)48(16,17)18/h19-28H,1-18H3 |
| InChIKey | IKQUCRWZNYCQJA-UHFFFAOYSA-N |
| XLogP | 14.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.12 |
| LogP ≤ 5 | 14.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|