C38H62P2 — CID 16689735
(2,4,6-tritert-butylphenyl)-[1-(2,4,6-tritert-butylphenyl)phosphanylethylidene]phosphane (PubChem CID 16689735) has the molecular formula C38H62P2 and a molecular weight of 580.86 g/mol. Its IUPAC name is (2,4,6-tritert-butylphenyl)-[1-(2,4,6-tritert-butylphenyl)phosphanylethylidene]phosphane.
| Compound Name | (2,4,6-tritert-butylphenyl)-[1-(2,4,6-tritert-butylphenyl)phosphanylethylidene]phosphane |
|---|---|
| PubChem CID | 16689735 |
| Molecular Formula | C38H62P2 |
| Molecular Weight | 580.86 g/mol |
| Exact Mass | 580.43 |
| IUPAC Name | (2,4,6-tritert-butylphenyl)-[1-(2,4,6-tritert-butylphenyl)phosphanylethylidene]phosphane |
| SMILES | C/C(=P\c1c(C(C)(C)C)cc(C(C)(C)C)cc1C(C)(C)C)Pc1c(C(C)(C)C)cc(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C38H62P2/c1-24(39-31-27(35(8,9)10)20-25(33(2,3)4)21-28(31)36(11,12)13)40-32-29(37(14,15)16)22-26(34(5,6)7)23-30(32)38(17,18)19/h20-23,39H,1-19H3 |
| InChIKey | JFPHATKWZPGULN-UHFFFAOYSA-N |
| XLogP | 11.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.86 |
| LogP ≤ 5 | 11.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|