C18H30OP- — CID 101376141
(2,4,6-tritert-butylphenyl)phosphinite (PubChem CID 101376141) has the molecular formula C18H30OP- and a molecular weight of 293.41 g/mol. Its IUPAC name is (2,4,6-tritert-butylphenyl)phosphinite.
| Compound Name | (2,4,6-tritert-butylphenyl)phosphinite |
|---|---|
| PubChem CID | 101376141 |
| Molecular Formula | C18H30OP- |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | (2,4,6-tritert-butylphenyl)phosphinite |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c(P[O-])c(C(C)(C)C)c1 |
| InChI | InChI=1S/C18H30OP/c1-16(2,3)12-10-13(17(4,5)6)15(20-19)14(11-12)18(7,8)9/h10-11,20H,1-9H3/q-1 |
| InChIKey | OWCWKCPQINTXTK-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|