C29H49PSi — CID 16685428
[dimethyl-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silyl]-(2,4,6-tritert-butylphenyl)phosphane (PubChem CID 16685428) has the molecular formula C29H49PSi and a molecular weight of 456.77 g/mol. Its IUPAC name is [dimethyl-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silyl]-(2,4,6-tritert-butylphenyl)phosphane.
| Compound Name | [dimethyl-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silyl]-(2,4,6-tritert-butylphenyl)phosphane |
|---|---|
| PubChem CID | 16685428 |
| Molecular Formula | C29H49PSi |
| Molecular Weight | 456.77 g/mol |
| Exact Mass | 456.33 |
| IUPAC Name | [dimethyl-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silyl]-(2,4,6-tritert-butylphenyl)phosphane |
| SMILES | CC1=C(C)C([Si](C)(C)Pc2c(C(C)(C)C)cc(C(C)(C)C)cc2C(C)(C)C)C(C)=C1C |
| InChI | InChI=1S/C29H49PSi/c1-18-19(2)21(4)26(20(18)3)31(14,15)30-25-23(28(8,9)10)16-22(27(5,6)7)17-24(25)29(11,12)13/h16-17,26,30H,1-15H3 |
| InChIKey | ARVHTMZROSFFOK-UHFFFAOYSA-N |
| XLogP | 9.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.77 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|