C27H36OSi — CID 102299898
2-tert-butyl-4-methyl-6-[methyl-phenyl-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silyl]phenol (PubChem CID 102299898) has the molecular formula C27H36OSi and a molecular weight of 404.67 g/mol. Its IUPAC name is 2-tert-butyl-4-methyl-6-[methyl-phenyl-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silyl]phenol.
| Compound Name | 2-tert-butyl-4-methyl-6-[methyl-phenyl-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silyl]phenol |
|---|---|
| PubChem CID | 102299898 |
| Molecular Formula | C27H36OSi |
| Molecular Weight | 404.67 g/mol |
| Exact Mass | 404.25 |
| IUPAC Name | 2-tert-butyl-4-methyl-6-[methyl-phenyl-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silyl]phenol |
| SMILES | CC1=C(C)C([Si](C)(c2ccccc2)c2cc(C)cc(C(C)(C)C)c2O)C(C)=C1C |
| InChI | InChI=1S/C27H36OSi/c1-17-15-23(27(6,7)8)25(28)24(16-17)29(9,22-13-11-10-12-14-22)26-20(4)18(2)19(3)21(26)5/h10-16,26,28H,1-9H3 |
| InChIKey | OGLORQHEOJSDOG-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.67 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|