C23H27OP — CID 139753681
2-tert-butyl-4-methyl-6-[(1-methylcyclopenta-2,4-dien-1-yl)-phenylphosphanyl]phenol (PubChem CID 139753681) has the molecular formula C23H27OP and a molecular weight of 350.44 g/mol. Its IUPAC name is 2-tert-butyl-4-methyl-6-[(1-methylcyclopenta-2,4-dien-1-yl)-phenylphosphanyl]phenol.
| Compound Name | 2-tert-butyl-4-methyl-6-[(1-methylcyclopenta-2,4-dien-1-yl)-phenylphosphanyl]phenol |
|---|---|
| PubChem CID | 139753681 |
| Molecular Formula | C23H27OP |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | 2-tert-butyl-4-methyl-6-[(1-methylcyclopenta-2,4-dien-1-yl)-phenylphosphanyl]phenol |
| SMILES | Cc1cc(P(c2ccccc2)C2(C)C=CC=C2)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C23H27OP/c1-17-15-19(22(2,3)4)21(24)20(16-17)25(18-11-7-6-8-12-18)23(5)13-9-10-14-23/h6-16,24H,1-5H3 |
| InChIKey | PUYAHGATOWVMLK-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|