C45H70P2 — CID 101189276
(2,4,6-tritert-butylphenyl)-[9-(2,4,6-tritert-butylphenyl)phosphanylnona-1,8-diynyl]phosphane (PubChem CID 101189276) has the molecular formula C45H70P2 and a molecular weight of 673.00 g/mol. Its IUPAC name is (2,4,6-tritert-butylphenyl)-[9-(2,4,6-tritert-butylphenyl)phosphanylnona-1,8-diynyl]phosphane.
| Compound Name | (2,4,6-tritert-butylphenyl)-[9-(2,4,6-tritert-butylphenyl)phosphanylnona-1,8-diynyl]phosphane |
|---|---|
| PubChem CID | 101189276 |
| Molecular Formula | C45H70P2 |
| Molecular Weight | 673.00 g/mol |
| Exact Mass | 672.50 |
| IUPAC Name | (2,4,6-tritert-butylphenyl)-[9-(2,4,6-tritert-butylphenyl)phosphanylnona-1,8-diynyl]phosphane |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c(PC#CCCCCCC#CPc2c(C(C)(C)C)cc(C(C)(C)C)cc2C(C)(C)C)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C45H70P2/c1-40(2,3)32-28-34(42(7,8)9)38(35(29-32)43(10,11)12)46-26-24-22-20-19-21-23-25-27-47-39-36(44(13,14)15)30-33(41(4,5)6)31-37(39)45(16,17)18/h28-31,46-47H,19-23H2,1-18H3 |
| InChIKey | OWARHFPZKFJIAE-UHFFFAOYSA-N |
| XLogP | 12.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.00 |
| LogP ≤ 5 | 12.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|