C32H37P — CID 102303473
fluoren-9-ylidenemethylidene-(2,4,6-tritert-butylphenyl)phosphane (PubChem CID 102303473) has the molecular formula C32H37P and a molecular weight of 452.62 g/mol. Its IUPAC name is fluoren-9-ylidenemethylidene-(2,4,6-tritert-butylphenyl)phosphane.
| Compound Name | fluoren-9-ylidenemethylidene-(2,4,6-tritert-butylphenyl)phosphane |
|---|---|
| PubChem CID | 102303473 |
| Molecular Formula | C32H37P |
| Molecular Weight | 452.62 g/mol |
| Exact Mass | 452.26 |
| IUPAC Name | fluoren-9-ylidenemethylidene-(2,4,6-tritert-butylphenyl)phosphane |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c(P=C=C2c3ccccc3-c3ccccc32)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C32H37P/c1-30(2,3)21-18-27(31(4,5)6)29(28(19-21)32(7,8)9)33-20-26-24-16-12-10-14-22(24)23-15-11-13-17-25(23)26/h10-19H,1-9H3 |
| InChIKey | PWONETOHCADNPU-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.62 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|