C54H70Br2P2 — CID 134888306
[2,3-bis[bromo(phenyl)methyl]-4-(2,4,6-tritert-butylphenyl)phosphanylidenecyclobut-2-en-1-ylidene]-(2,4,6-tritert-butylphenyl)phosphane (PubChem CID 134888306) has the molecular formula C54H70Br2P2 and a molecular weight of 940.91 g/mol. Its IUPAC name is [2,3-bis[bromo(phenyl)methyl]-4-(2,4,6-tritert-butylphenyl)phosphanylidenecyclobut-2-en-1-ylidene]-(2,4,6-tritert-butylphenyl)phosphane.
| Compound Name | [2,3-bis[bromo(phenyl)methyl]-4-(2,4,6-tritert-butylphenyl)phosphanylidenecyclobut-2-en-1-ylidene]-(2,4,6-tritert-butylphenyl)phosphane |
|---|---|
| PubChem CID | 134888306 |
| Molecular Formula | C54H70Br2P2 |
| Molecular Weight | 940.91 g/mol |
| Exact Mass | 938.33 |
| IUPAC Name | [2,3-bis[bromo(phenyl)methyl]-4-(2,4,6-tritert-butylphenyl)phosphanylidenecyclobut-2-en-1-ylidene]-(2,4,6-tritert-butylphenyl)phosphane |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c(/P=c2/c(C(Br)c3ccccc3)c(C(Br)c3ccccc3)/c2=P\c2c(C(C)(C)C)cc(C(C)(C)C)cc2C(C)(C)C)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C54H70Br2P2/c1-49(2,3)35-29-37(51(7,8)9)45(38(30-35)52(10,11)12)57-47-41(43(55)33-25-21-19-22-26-33)42(44(56)34-27-23-20-24-28-34)48(47)58-46-39(53(13,14)15)31-36(50(4,5)6)32-40(46)54(16,17)18/h19-32,43-44H,1-18H3 |
| InChIKey | KIVFMQHAFNZWEL-UHFFFAOYSA-N |
| XLogP | 16.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 940.91 |
| LogP ≤ 5 | 16.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|