C46H58OsP2 — CID 134984697
1-methyl-4-propan-2-ylbenzene;(2,4,6-tritert-butylphenyl)phosphanylideneosmium;triphenylphosphane (PubChem CID 134984697) has the molecular formula C46H58OsP2 and a molecular weight of 863.15 g/mol. Its IUPAC name is 1-methyl-4-propan-2-ylbenzene;(2,4,6-tritert-butylphenyl)phosphanylideneosmium;triphenylphosphane.
| Compound Name | 1-methyl-4-propan-2-ylbenzene;(2,4,6-tritert-butylphenyl)phosphanylideneosmium;triphenylphosphane |
|---|---|
| PubChem CID | 134984697 |
| Molecular Formula | C46H58OsP2 |
| Molecular Weight | 863.15 g/mol |
| Exact Mass | 864.36 |
| IUPAC Name | 1-methyl-4-propan-2-ylbenzene;(2,4,6-tritert-butylphenyl)phosphanylideneosmium;triphenylphosphane |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c(P=[Os])c(C(C)(C)C)c1.Cc1ccc(C(C)C)cc1.c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.C18H29P.C10H14.Os/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-16(2,3)12-10-13(17(4,5)6)15(19)14(11-12)18(7,8)9;1-8(2)10-6-4-9(3)5-7-10;/h1-15H;10-11H,1-9H3;4-8H,1-3H3; |
| InChIKey | XFIMNMJZSSQTAB-UHFFFAOYSA-N |
| XLogP | 12.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 863.15 |
| LogP ≤ 5 | 12.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|