C12H5Cl2F — CID 24974279
(6,6-dichloro-5-fluorohex-5-en-1,3-diynyl)benzene (PubChem CID 24974279) has the molecular formula C12H5Cl2F and a molecular weight of 239.08 g/mol. Its IUPAC name is (6,6-dichloro-5-fluorohex-5-en-1,3-diynyl)benzene.
| Compound Name | (6,6-dichloro-5-fluorohex-5-en-1,3-diynyl)benzene |
|---|---|
| PubChem CID | 24974279 |
| Molecular Formula | C12H5Cl2F |
| Molecular Weight | 239.08 g/mol |
| Exact Mass | 237.98 |
| IUPAC Name | (6,6-dichloro-5-fluorohex-5-en-1,3-diynyl)benzene |
| SMILES | FC(C#CC#Cc1ccccc1)=C(Cl)Cl |
| InChI | InChI=1S/C12H5Cl2F/c13-12(14)11(15)9-5-4-8-10-6-2-1-3-7-10/h1-3,6-7H |
| InChIKey | PZOONOZNMVELRB-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.08 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|