C11H5FO2 — CID 119088669
5-(4-fluorophenyl)penta-2,4-diynoic acid (PubChem CID 119088669) has the molecular formula C11H5FO2 and a molecular weight of 188.16 g/mol. Its IUPAC name is 5-(4-fluorophenyl)penta-2,4-diynoic acid.
| Compound Name | 5-(4-fluorophenyl)penta-2,4-diynoic acid |
|---|---|
| PubChem CID | 119088669 |
| Molecular Formula | C11H5FO2 |
| Molecular Weight | 188.16 g/mol |
| Exact Mass | 188.03 |
| IUPAC Name | 5-(4-fluorophenyl)penta-2,4-diynoic acid |
| SMILES | O=C(O)C#CC#Cc1ccc(F)cc1 |
| InChI | InChI=1S/C11H5FO2/c12-10-7-5-9(6-8-10)3-1-2-4-11(13)14/h5-8H,(H,13,14) |
| InChIKey | GRVFRRZLEZZWAQ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.16 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|