5-(4-fluorophenyl)penta-2,4-diynoic acid

C11H5FO2 — CID 119088669

IUPAC5-(4-fluorophenyl)penta-2,4-diynoic acid
SMILESO=C(O)C#CC#Cc1ccc(F)cc1
InChIInChI=1S/C11H5FO2/c12-10-7-5-9(6-8-10)3-1-2-4-11(13)14/h5-8H,(H,13,14)
InChIKeyGRVFRRZLEZZWAQ-UHFFFAOYSA-N
MW188.16 g/mol
LogP1.27
Rot. Bonds

About 5-(4-fluorophenyl)penta-2,4-diynoic acid

5-(4-fluorophenyl)penta-2,4-diynoic acid (PubChem CID 119088669) has the molecular formula C11H5FO2 and a molecular weight of 188.16 g/mol. Its IUPAC name is 5-(4-fluorophenyl)penta-2,4-diynoic acid.

Molecular Properties

Compound Name5-(4-fluorophenyl)penta-2,4-diynoic acid
PubChem CID119088669
Molecular FormulaC11H5FO2
Molecular Weight188.16 g/mol
Exact Mass188.03
IUPAC Name5-(4-fluorophenyl)penta-2,4-diynoic acid
SMILESO=C(O)C#CC#Cc1ccc(F)cc1
InChIInChI=1S/C11H5FO2/c12-10-7-5-9(6-8-10)3-1-2-4-11(13)14/h5-8H,(H,13,14)
InChIKeyGRVFRRZLEZZWAQ-UHFFFAOYSA-N
XLogP1.27
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500188.16
LogP ≤ 51.27
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'triple_bond', 'substructure': 'N/A'}

Analyze 5-(4-fluorophenyl)penta-2,4-diynoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(4-fluorophenyl)penta-2,4-diynoic acid?
The IUPAC name of 5-(4-fluorophenyl)penta-2,4-diynoic acid (CID 119088669) is 5-(4-fluorophenyl)penta-2,4-diynoic acid.
What is the SMILES notation for 5-(4-fluorophenyl)penta-2,4-diynoic acid?
The canonical SMILES for 5-(4-fluorophenyl)penta-2,4-diynoic acid is O=C(O)C#CC#Cc1ccc(F)cc1.
What is the InChIKey of 5-(4-fluorophenyl)penta-2,4-diynoic acid?
The InChIKey is GRVFRRZLEZZWAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H5FO2/c12-10-7-5-9(6-8-10)3-1-2-4-11(13)14/h5-8H,(H,13,14).
What are the key properties of 5-(4-fluorophenyl)penta-2,4-diynoic acid?
5-(4-fluorophenyl)penta-2,4-diynoic acid has a molecular weight of 188.16 g/mol, XLogP of 1.27, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-fluorophenyl)penta-2,4-diynoic acid is sourced from PubChem (CID 119088669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).