C23H18FNO — CID 169084149
N,N-dibenzyl-3-(4-fluorophenyl)prop-2-ynamide (PubChem CID 169084149) has the molecular formula C23H18FNO and a molecular weight of 343.40 g/mol. Its IUPAC name is N,N-dibenzyl-3-(4-fluorophenyl)prop-2-ynamide.
| Compound Name | N,N-dibenzyl-3-(4-fluorophenyl)prop-2-ynamide |
|---|---|
| PubChem CID | 169084149 |
| Molecular Formula | C23H18FNO |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | N,N-dibenzyl-3-(4-fluorophenyl)prop-2-ynamide |
| SMILES | O=C(C#Cc1ccc(F)cc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C23H18FNO/c24-22-14-11-19(12-15-22)13-16-23(26)25(17-20-7-3-1-4-8-20)18-21-9-5-2-6-10-21/h1-12,14-15H,17-18H2 |
| InChIKey | PAKYDWHXCZGONA-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|