C23H23FN2O — CID 108902120
1,1-dibenzyl-3-[2-(4-fluorophenyl)ethyl]urea (PubChem CID 108902120) has the molecular formula C23H23FN2O and a molecular weight of 362.45 g/mol. Its IUPAC name is 1,1-dibenzyl-3-[2-(4-fluorophenyl)ethyl]urea.
| Compound Name | 1,1-dibenzyl-3-[2-(4-fluorophenyl)ethyl]urea |
|---|---|
| PubChem CID | 108902120 |
| Molecular Formula | C23H23FN2O |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | 1,1-dibenzyl-3-[2-(4-fluorophenyl)ethyl]urea |
| SMILES | O=C(NCCc1ccc(F)cc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C23H23FN2O/c24-22-13-11-19(12-14-22)15-16-25-23(27)26(17-20-7-3-1-4-8-20)18-21-9-5-2-6-10-21/h1-14H,15-18H2,(H,25,27) |
| InChIKey | JNWLQSDRGBWYSP-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |