C24H26N2O — CID 108891110
1,1-dibenzyl-3-[2-(4-methylphenyl)ethyl]urea (PubChem CID 108891110) has the molecular formula C24H26N2O and a molecular weight of 358.49 g/mol. Its IUPAC name is 1,1-dibenzyl-3-[2-(4-methylphenyl)ethyl]urea.
| Compound Name | 1,1-dibenzyl-3-[2-(4-methylphenyl)ethyl]urea |
|---|---|
| PubChem CID | 108891110 |
| Molecular Formula | C24H26N2O |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | 1,1-dibenzyl-3-[2-(4-methylphenyl)ethyl]urea |
| SMILES | Cc1ccc(CCNC(=O)N(Cc2ccccc2)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C24H26N2O/c1-20-12-14-21(15-13-20)16-17-25-24(27)26(18-22-8-4-2-5-9-22)19-23-10-6-3-7-11-23/h2-15H,16-19H2,1H3,(H,25,27) |
| InChIKey | IENKYXMFZACMSP-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |