About 2-oxopropyl 3-(4-fluorophenyl)prop-2-ynoate
2-oxopropyl 3-(4-fluorophenyl)prop-2-ynoate (PubChem CID 172809808) has the molecular formula C12H9FO3
and a molecular weight of 220.20 g/mol. Its IUPAC name is 2-oxopropyl 3-(4-fluorophenyl)prop-2-ynoate.
Molecular Properties
| Compound Name | 2-oxopropyl 3-(4-fluorophenyl)prop-2-ynoate |
| PubChem CID | 172809808 |
| Molecular Formula | C12H9FO3 |
| Molecular Weight | 220.20 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | 2-oxopropyl 3-(4-fluorophenyl)prop-2-ynoate |
| SMILES | CC(=O)COC(=O)C#Cc1ccc(F)cc1 |
| InChI | InChI=1S/C12H9FO3/c1-9(14)8-16-12(15)7-4-10-2-5-11(13)6-3-10/h2-3,5-6H,8H2,1H3 |
| InChIKey | SACDSCIEDOYIIE-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.20 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-oxopropyl 3-(4-fluorophenyl)prop-2-ynoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxopropyl 3-(4-fluorophenyl)prop-2-ynoate?
The IUPAC name of 2-oxopropyl 3-(4-fluorophenyl)prop-2-ynoate (CID 172809808) is 2-oxopropyl 3-(4-fluorophenyl)prop-2-ynoate.
What is the SMILES notation for 2-oxopropyl 3-(4-fluorophenyl)prop-2-ynoate?
The canonical SMILES for 2-oxopropyl 3-(4-fluorophenyl)prop-2-ynoate is CC(=O)COC(=O)C#Cc1ccc(F)cc1.
What is the InChIKey of 2-oxopropyl 3-(4-fluorophenyl)prop-2-ynoate?
The InChIKey is SACDSCIEDOYIIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9FO3/c1-9(14)8-16-12(15)7-4-10-2-5-11(13)6-3-10/h2-3,5-6H,8H2,1H3.
What are the key properties of 2-oxopropyl 3-(4-fluorophenyl)prop-2-ynoate?
2-oxopropyl 3-(4-fluorophenyl)prop-2-ynoate has a molecular weight of 220.20 g/mol, XLogP of 1.31, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxopropyl 3-(4-fluorophenyl)prop-2-ynoate is sourced from PubChem (CID 172809808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).