About CID 177486911
CID 177486911 (PubChem CID 177486911) has the molecular formula C9H7FO2
and a molecular weight of 166.15 g/mol.
Molecular Properties
| Compound Name | CID 177486911 |
| PubChem CID | 177486911 |
| Molecular Formula | C9H7FO2 |
| Molecular Weight | 166.15 g/mol |
| Exact Mass | 166.04 |
| IUPAC Name | — |
| SMILES | COC(=O)[C]c1ccc(F)cc1 |
| InChI | InChI=1S/C9H7FO2/c1-12-9(11)6-7-2-4-8(10)5-3-7/h2-5H,1H3 |
| InChIKey | BPYSVAKFMFVTAL-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.15 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 177486911 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 177486911?
The IUPAC name of CID 177486911 (CID 177486911) is not available.
What is the SMILES notation for CID 177486911?
The canonical SMILES for CID 177486911 is COC(=O)[C]c1ccc(F)cc1.
What is the InChIKey of CID 177486911?
The InChIKey is BPYSVAKFMFVTAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7FO2/c1-12-9(11)6-7-2-4-8(10)5-3-7/h2-5H,1H3.
What are the key properties of CID 177486911?
CID 177486911 has a molecular weight of 166.15 g/mol, XLogP of 1.43, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 177486911 is sourced from PubChem (CID 177486911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).