C18H16FNO3 — CID 90548123
N-[3-(4-fluorophenyl)prop-2-ynyl]-3,5-dimethoxybenzamide (PubChem CID 90548123) has the molecular formula C18H16FNO3 and a molecular weight of 313.33 g/mol. Its IUPAC name is N-[3-(4-fluorophenyl)prop-2-ynyl]-3,5-dimethoxybenzamide.
| Compound Name | N-[3-(4-fluorophenyl)prop-2-ynyl]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 90548123 |
| Molecular Formula | C18H16FNO3 |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | N-[3-(4-fluorophenyl)prop-2-ynyl]-3,5-dimethoxybenzamide |
| SMILES | COc1cc(OC)cc(C(=O)NCC#Cc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C18H16FNO3/c1-22-16-10-14(11-17(12-16)23-2)18(21)20-9-3-4-13-5-7-15(19)8-6-13/h5-8,10-12H,9H2,1-2H3,(H,20,21) |
| InChIKey | DVSXLNZYHRUTLP-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|