About [2-(4-fluorophenyl)-2-oxoethyl] 3-phenylprop-2-ynoate
[2-(4-fluorophenyl)-2-oxoethyl] 3-phenylprop-2-ynoate (PubChem CID 102518021) has the molecular formula C17H11FO3
and a molecular weight of 282.27 g/mol. Its IUPAC name is [2-(4-fluorophenyl)-2-oxoethyl] 3-phenylprop-2-ynoate.
Molecular Properties
| Compound Name | [2-(4-fluorophenyl)-2-oxoethyl] 3-phenylprop-2-ynoate |
| PubChem CID | 102518021 |
| Molecular Formula | C17H11FO3 |
| Molecular Weight | 282.27 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | [2-(4-fluorophenyl)-2-oxoethyl] 3-phenylprop-2-ynoate |
| SMILES | O=C(C#Cc1ccccc1)OCC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H11FO3/c18-15-9-7-14(8-10-15)16(19)12-21-17(20)11-6-13-4-2-1-3-5-13/h1-5,7-10H,12H2 |
| InChIKey | MGALKMVWMPSPRW-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.27 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [2-(4-fluorophenyl)-2-oxoethyl] 3-phenylprop-2-ynoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4-fluorophenyl)-2-oxoethyl] 3-phenylprop-2-ynoate?
The IUPAC name of [2-(4-fluorophenyl)-2-oxoethyl] 3-phenylprop-2-ynoate (CID 102518021) is [2-(4-fluorophenyl)-2-oxoethyl] 3-phenylprop-2-ynoate.
What is the SMILES notation for [2-(4-fluorophenyl)-2-oxoethyl] 3-phenylprop-2-ynoate?
The canonical SMILES for [2-(4-fluorophenyl)-2-oxoethyl] 3-phenylprop-2-ynoate is O=C(C#Cc1ccccc1)OCC(=O)c1ccc(F)cc1.
What is the InChIKey of [2-(4-fluorophenyl)-2-oxoethyl] 3-phenylprop-2-ynoate?
The InChIKey is MGALKMVWMPSPRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11FO3/c18-15-9-7-14(8-10-15)16(19)12-21-17(20)11-6-13-4-2-1-3-5-13/h1-5,7-10H,12H2.
What are the key properties of [2-(4-fluorophenyl)-2-oxoethyl] 3-phenylprop-2-ynoate?
[2-(4-fluorophenyl)-2-oxoethyl] 3-phenylprop-2-ynoate has a molecular weight of 282.27 g/mol, XLogP of 2.60, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4-fluorophenyl)-2-oxoethyl] 3-phenylprop-2-ynoate is sourced from PubChem (CID 102518021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).