C24H19F2NO4 — CID 3904587
[2-(4-fluorophenyl)-2-oxoethyl] 2-(4-fluoroanilino)-4-oxo-4-phenylbutanoate (PubChem CID 3904587) has the molecular formula C24H19F2NO4 and a molecular weight of 423.42 g/mol. Its IUPAC name is [2-(4-fluorophenyl)-2-oxoethyl] 2-(4-fluoroanilino)-4-oxo-4-phenylbutanoate.
| Compound Name | [2-(4-fluorophenyl)-2-oxoethyl] 2-(4-fluoroanilino)-4-oxo-4-phenylbutanoate |
|---|---|
| PubChem CID | 3904587 |
| Molecular Formula | C24H19F2NO4 |
| Molecular Weight | 423.42 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | [2-(4-fluorophenyl)-2-oxoethyl] 2-(4-fluoroanilino)-4-oxo-4-phenylbutanoate |
| SMILES | O=C(COC(=O)C(CC(=O)c1ccccc1)Nc1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C24H19F2NO4/c25-18-8-6-17(7-9-18)23(29)15-31-24(30)21(27-20-12-10-19(26)11-13-20)14-22(28)16-4-2-1-3-5-16/h1-13,21,27H,14-15H2 |
| InChIKey | PWUIWZIQIWFFNK-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.42 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |