C24H20BrNO4 — CID 41039145
[2-(4-bromophenyl)-2-oxoethyl] (2S)-2-anilino-4-oxo-4-phenylbutanoate (PubChem CID 41039145) has the molecular formula C24H20BrNO4 and a molecular weight of 466.33 g/mol. Its IUPAC name is [2-(4-bromophenyl)-2-oxoethyl] (2S)-2-anilino-4-oxo-4-phenylbutanoate.
| Compound Name | [2-(4-bromophenyl)-2-oxoethyl] (2S)-2-anilino-4-oxo-4-phenylbutanoate |
|---|---|
| PubChem CID | 41039145 |
| Molecular Formula | C24H20BrNO4 |
| Molecular Weight | 466.33 g/mol |
| Exact Mass | 465.06 |
| IUPAC Name | [2-(4-bromophenyl)-2-oxoethyl] (2S)-2-anilino-4-oxo-4-phenylbutanoate |
| SMILES | O=C(COC(=O)[C@H](CC(=O)c1ccccc1)Nc1ccccc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C24H20BrNO4/c25-19-13-11-18(12-14-19)23(28)16-30-24(29)21(26-20-9-5-2-6-10-20)15-22(27)17-7-3-1-4-8-17/h1-14,21,26H,15-16H2/t21-/m0/s1 |
| InChIKey | HXMDTWMWGYPKMN-NRFANRHFSA-N |
| XLogP | 4.93 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.33 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |