C18H12S2 — CID 72543052
1,6-diphenylhex-3-en-1,5-diyne-3,4-dithiol (PubChem CID 72543052) has the molecular formula C18H12S2 and a molecular weight of 292.43 g/mol. Its IUPAC name is 1,6-diphenylhex-3-en-1,5-diyne-3,4-dithiol.
| Compound Name | 1,6-diphenylhex-3-en-1,5-diyne-3,4-dithiol |
|---|---|
| PubChem CID | 72543052 |
| Molecular Formula | C18H12S2 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.04 |
| IUPAC Name | 1,6-diphenylhex-3-en-1,5-diyne-3,4-dithiol |
| SMILES | SC(C#Cc1ccccc1)=C(S)C#Cc1ccccc1 |
| InChI | InChI=1S/C18H12S2/c19-17(13-11-15-7-3-1-4-8-15)18(20)14-12-16-9-5-2-6-10-16/h1-10,19-20H |
| InChIKey | GMKOYPIWHYWNHD-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|