C22H30OS — CID 164682070
2,6-ditert-butyl-4-[(4-methylphenyl)sulfanylmethyl]phenol (PubChem CID 164682070) has the molecular formula C22H30OS and a molecular weight of 342.55 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[(4-methylphenyl)sulfanylmethyl]phenol.
| Compound Name | 2,6-ditert-butyl-4-[(4-methylphenyl)sulfanylmethyl]phenol |
|---|---|
| PubChem CID | 164682070 |
| Molecular Formula | C22H30OS |
| Molecular Weight | 342.55 g/mol |
| Exact Mass | 342.20 |
| IUPAC Name | 2,6-ditert-butyl-4-[(4-methylphenyl)sulfanylmethyl]phenol |
| SMILES | Cc1ccc(SCc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)cc1 |
| InChI | InChI=1S/C22H30OS/c1-15-8-10-17(11-9-15)24-14-16-12-18(21(2,3)4)20(23)19(13-16)22(5,6)7/h8-13,23H,14H2,1-7H3 |
| InChIKey | IRVDWVZFHNZGQS-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.55 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |