C14H14O2S — CID 10538397
2-[(4-methylphenyl)sulfanylmethyl]benzene-1,3-diol (PubChem CID 10538397) has the molecular formula C14H14O2S and a molecular weight of 246.33 g/mol. Its IUPAC name is 2-[(4-methylphenyl)sulfanylmethyl]benzene-1,3-diol.
| Compound Name | 2-[(4-methylphenyl)sulfanylmethyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 10538397 |
| Molecular Formula | C14H14O2S |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | 2-[(4-methylphenyl)sulfanylmethyl]benzene-1,3-diol |
| SMILES | Cc1ccc(SCc2c(O)cccc2O)cc1 |
| InChI | InChI=1S/C14H14O2S/c1-10-5-7-11(8-6-10)17-9-12-13(15)3-2-4-14(12)16/h2-8,15-16H,9H2,1H3 |
| InChIKey | AJDLOAWMMJEBAU-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |