C22H32NO+ — CID 59712654
(3,5-ditert-butyl-4-hydroxyphenyl)-[(4-methylphenyl)methyl]azanium (PubChem CID 59712654) has the molecular formula C22H32NO+ and a molecular weight of 326.50 g/mol. Its IUPAC name is (3,5-ditert-butyl-4-hydroxyphenyl)-[(4-methylphenyl)methyl]azanium.
| Compound Name | (3,5-ditert-butyl-4-hydroxyphenyl)-[(4-methylphenyl)methyl]azanium |
|---|---|
| PubChem CID | 59712654 |
| Molecular Formula | C22H32NO+ |
| Molecular Weight | 326.50 g/mol |
| Exact Mass | 326.25 |
| IUPAC Name | (3,5-ditert-butyl-4-hydroxyphenyl)-[(4-methylphenyl)methyl]azanium |
| SMILES | Cc1ccc(C[NH2+]c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)cc1 |
| InChI | InChI=1S/C22H31NO/c1-15-8-10-16(11-9-15)14-23-17-12-18(21(2,3)4)20(24)19(13-17)22(5,6)7/h8-13,23-24H,14H2,1-7H3/p+1 |
| InChIKey | QPMCOTKKBDVHRB-UHFFFAOYSA-O |
| XLogP | 4.69 |
| TPSA | 36.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.50 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|