C36H51PSi — CID 13172407
bis(2,4,6-trimethylphenyl)silylidene-(2,4,6-tritert-butylphenyl)phosphane (PubChem CID 13172407) has the molecular formula C36H51PSi and a molecular weight of 542.86 g/mol. Its IUPAC name is bis(2,4,6-trimethylphenyl)silylidene-(2,4,6-tritert-butylphenyl)phosphane.
| Compound Name | bis(2,4,6-trimethylphenyl)silylidene-(2,4,6-tritert-butylphenyl)phosphane |
|---|---|
| PubChem CID | 13172407 |
| Molecular Formula | C36H51PSi |
| Molecular Weight | 542.86 g/mol |
| Exact Mass | 542.35 |
| IUPAC Name | bis(2,4,6-trimethylphenyl)silylidene-(2,4,6-tritert-butylphenyl)phosphane |
| SMILES | Cc1cc(C)c([Si](=Pc2c(C(C)(C)C)cc(C(C)(C)C)cc2C(C)(C)C)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C36H51PSi/c1-22-16-24(3)32(25(4)17-22)38(33-26(5)18-23(2)19-27(33)6)37-31-29(35(10,11)12)20-28(34(7,8)9)21-30(31)36(13,14)15/h16-21H,1-15H3 |
| InChIKey | HFTYJOJWAZANLV-UHFFFAOYSA-N |
| XLogP | 8.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.86 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|