C26H40Si2 — CID 13265296
(E)-tert-butyl-[tert-butyl-(2,4,6-trimethylphenyl)silylidene]-(2,4,6-trimethylphenyl)silane (PubChem CID 13265296) has the molecular formula C26H40Si2 and a molecular weight of 408.78 g/mol. Its IUPAC name is (E)-tert-butyl-[tert-butyl-(2,4,6-trimethylphenyl)silylidene]-(2,4,6-trimethylphenyl)silane.
| Compound Name | (E)-tert-butyl-[tert-butyl-(2,4,6-trimethylphenyl)silylidene]-(2,4,6-trimethylphenyl)silane |
|---|---|
| PubChem CID | 13265296 |
| Molecular Formula | C26H40Si2 |
| Molecular Weight | 408.78 g/mol |
| Exact Mass | 408.27 |
| IUPAC Name | (E)-tert-butyl-[tert-butyl-(2,4,6-trimethylphenyl)silylidene]-(2,4,6-trimethylphenyl)silane |
| SMILES | Cc1cc(C)c(/[Si](=[Si](/c2c(C)cc(C)cc2C)C(C)(C)C)C(C)(C)C)c(C)c1 |
| InChI | InChI=1S/C26H40Si2/c1-17-13-19(3)23(20(4)14-17)27(25(7,8)9)28(26(10,11)12)24-21(5)15-18(2)16-22(24)6/h13-16H,1-12H3/b28-27+ |
| InChIKey | OHEJGIWHGUUYMX-BYYHNAKLSA-N |
| XLogP | 6.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.78 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|