About bis[2-(2,4,6-trimethylphenyl)propan-2-yl]diazene
bis[2-(2,4,6-trimethylphenyl)propan-2-yl]diazene (PubChem CID 10247336) has the molecular formula C24H34N2
and a molecular weight of 350.55 g/mol. Its IUPAC name is bis[2-(2,4,6-trimethylphenyl)propan-2-yl]diazene.
Molecular Properties
| Compound Name | bis[2-(2,4,6-trimethylphenyl)propan-2-yl]diazene |
| PubChem CID | 10247336 |
| Molecular Formula | C24H34N2 |
| Molecular Weight | 350.55 g/mol |
| Exact Mass | 350.27 |
| IUPAC Name | bis[2-(2,4,6-trimethylphenyl)propan-2-yl]diazene |
| SMILES | Cc1cc(C)c(C(C)(C)/N=N/C(C)(C)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C24H34N2/c1-15-11-17(3)21(18(4)12-15)23(7,8)25-26-24(9,10)22-19(5)13-16(2)14-20(22)6/h11-14H,1-10H3/b26-25+ |
| InChIKey | ZHPMUBJIRQHXEQ-OCEACIFDSA-N |
| XLogP | 7.16 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 350.55 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze bis[2-(2,4,6-trimethylphenyl)propan-2-yl]diazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[2-(2,4,6-trimethylphenyl)propan-2-yl]diazene?
The IUPAC name of bis[2-(2,4,6-trimethylphenyl)propan-2-yl]diazene (CID 10247336) is bis[2-(2,4,6-trimethylphenyl)propan-2-yl]diazene.
What is the SMILES notation for bis[2-(2,4,6-trimethylphenyl)propan-2-yl]diazene?
The canonical SMILES for bis[2-(2,4,6-trimethylphenyl)propan-2-yl]diazene is Cc1cc(C)c(C(C)(C)/N=N/C(C)(C)c2c(C)cc(C)cc2C)c(C)c1.
What is the InChIKey of bis[2-(2,4,6-trimethylphenyl)propan-2-yl]diazene?
The InChIKey is ZHPMUBJIRQHXEQ-OCEACIFDSA-N. The full InChI is InChI=1S/C24H34N2/c1-15-11-17(3)21(18(4)12-15)23(7,8)25-26-24(9,10)22-19(5)13-16(2)14-20(22)6/h11-14H,1-10H3/b26-25+.
What are the key properties of bis[2-(2,4,6-trimethylphenyl)propan-2-yl]diazene?
bis[2-(2,4,6-trimethylphenyl)propan-2-yl]diazene has a molecular weight of 350.55 g/mol, XLogP of 7.16, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis[2-(2,4,6-trimethylphenyl)propan-2-yl]diazene is sourced from PubChem (CID 10247336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).