About CID 11227571
CID 11227571 (PubChem CID 11227571) has the molecular formula C36H64GeSi3
and a molecular weight of 653.78 g/mol.
Molecular Properties
| Compound Name | CID 11227571 |
| PubChem CID | 11227571 |
| Molecular Formula | C36H64GeSi3 |
| Molecular Weight | 653.78 g/mol |
| Exact Mass | 654.35 |
| IUPAC Name | — |
| SMILES | C[Si](C(C)(C)C)C(C)(C)C.C[Si](C(C)(C)C)C(C)(C)C.Cc1cc(C)c([Si](=[Ge])c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C18H22GeSi.2C9H21Si/c1-11-7-13(3)17(14(4)8-11)20(19)18-15(5)9-12(2)10-16(18)6;2*1-8(2,3)10(7)9(4,5)6/h7-10H,1-6H3;2*1-7H3 |
| InChIKey | XIXNPZFKFVAOGP-UHFFFAOYSA-N |
| XLogP | 10.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 653.78 |
| LogP ≤ 5 | 10.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 11227571 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11227571?
The IUPAC name of CID 11227571 (CID 11227571) is not available.
What is the SMILES notation for CID 11227571?
The canonical SMILES for CID 11227571 is C[Si](C(C)(C)C)C(C)(C)C.C[Si](C(C)(C)C)C(C)(C)C.Cc1cc(C)c([Si](=[Ge])c2c(C)cc(C)cc2C)c(C)c1.
What is the InChIKey of CID 11227571?
The InChIKey is XIXNPZFKFVAOGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22GeSi.2C9H21Si/c1-11-7-13(3)17(14(4)8-11)20(19)18-15(5)9-12(2)10-16(18)6;2*1-8(2,3)10(7)9(4,5)6/h7-10H,1-6H3;2*1-7H3.
What are the key properties of CID 11227571?
CID 11227571 has a molecular weight of 653.78 g/mol, XLogP of 10.23, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11227571 is sourced from PubChem (CID 11227571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).