About CID 19959791
CID 19959791 (PubChem CID 19959791) has the molecular formula C27H33Si3
and a molecular weight of 441.82 g/mol.
Molecular Properties
| Compound Name | CID 19959791 |
| PubChem CID | 19959791 |
| Molecular Formula | C27H33Si3 |
| Molecular Weight | 441.82 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | — |
| SMILES | Cc1cc(C)c([Si][Si]([Si]c2c(C)cc(C)cc2C)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C27H33Si3/c1-16-10-19(4)25(20(5)11-16)28-30(27-23(8)14-18(3)15-24(27)9)29-26-21(6)12-17(2)13-22(26)7/h10-15H,1-9H3 |
| InChIKey | BTEHIXUZBMHURN-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 441.82 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 19959791 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 19959791?
The IUPAC name of CID 19959791 (CID 19959791) is not available.
What is the SMILES notation for CID 19959791?
The canonical SMILES for CID 19959791 is Cc1cc(C)c([Si][Si]([Si]c2c(C)cc(C)cc2C)c2c(C)cc(C)cc2C)c(C)c1.
What is the InChIKey of CID 19959791?
The InChIKey is BTEHIXUZBMHURN-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H33Si3/c1-16-10-19(4)25(20(5)11-16)28-30(27-23(8)14-18(3)15-24(27)9)29-26-21(6)12-17(2)13-22(26)7/h10-15H,1-9H3.
What are the key properties of CID 19959791?
CID 19959791 has a molecular weight of 441.82 g/mol, XLogP of 4.22, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 19959791 is sourced from PubChem (CID 19959791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).