C13H20O2S — CID 4069856
2-tert-butylsulfonyl-1,3,5-trimethylbenzene (PubChem CID 4069856) has the molecular formula C13H20O2S and a molecular weight of 240.37 g/mol. Its IUPAC name is 2-tert-butylsulfonyl-1,3,5-trimethylbenzene.
| Compound Name | 2-tert-butylsulfonyl-1,3,5-trimethylbenzene |
|---|---|
| PubChem CID | 4069856 |
| Molecular Formula | C13H20O2S |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | 2-tert-butylsulfonyl-1,3,5-trimethylbenzene |
| SMILES | Cc1cc(C)c(S(=O)(=O)C(C)(C)C)c(C)c1 |
| InChI | InChI=1S/C13H20O2S/c1-9-7-10(2)12(11(3)8-9)16(14,15)13(4,5)6/h7-8H,1-6H3 |
| InChIKey | CWCKYCWUAWQPGW-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |