About 2-tert-butylsulfonyl-1,3,5-trimethylbenzene
2-tert-butylsulfonyl-1,3,5-trimethylbenzene (PubChem CID 4069856) has the molecular formula C13H20O2S
and a molecular weight of 240.37 g/mol. Its IUPAC name is 2-tert-butylsulfonyl-1,3,5-trimethylbenzene.
Molecular Properties
| Compound Name | 2-tert-butylsulfonyl-1,3,5-trimethylbenzene |
| PubChem CID | 4069856 |
| Molecular Formula | C13H20O2S |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | 2-tert-butylsulfonyl-1,3,5-trimethylbenzene |
| SMILES | Cc1cc(C)c(S(=O)(=O)C(C)(C)C)c(C)c1 |
| InChI | InChI=1S/C13H20O2S/c1-9-7-10(2)12(11(3)8-9)16(14,15)13(4,5)6/h7-8H,1-6H3 |
| InChIKey | CWCKYCWUAWQPGW-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-tert-butylsulfonyl-1,3,5-trimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butylsulfonyl-1,3,5-trimethylbenzene?
The IUPAC name of 2-tert-butylsulfonyl-1,3,5-trimethylbenzene (CID 4069856) is 2-tert-butylsulfonyl-1,3,5-trimethylbenzene.
What is the SMILES notation for 2-tert-butylsulfonyl-1,3,5-trimethylbenzene?
The canonical SMILES for 2-tert-butylsulfonyl-1,3,5-trimethylbenzene is Cc1cc(C)c(S(=O)(=O)C(C)(C)C)c(C)c1.
What is the InChIKey of 2-tert-butylsulfonyl-1,3,5-trimethylbenzene?
The InChIKey is CWCKYCWUAWQPGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O2S/c1-9-7-10(2)12(11(3)8-9)16(14,15)13(4,5)6/h7-8H,1-6H3.
What are the key properties of 2-tert-butylsulfonyl-1,3,5-trimethylbenzene?
2-tert-butylsulfonyl-1,3,5-trimethylbenzene has a molecular weight of 240.37 g/mol, XLogP of 3.18, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butylsulfonyl-1,3,5-trimethylbenzene is sourced from PubChem (CID 4069856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).