C10H14O2S — CID 577272
1,3,5-trimethyl-2-methylsulfonylbenzene (PubChem CID 577272) has the molecular formula C10H14O2S and a molecular weight of 198.29 g/mol. Its IUPAC name is 1,3,5-trimethyl-2-methylsulfonylbenzene.
| Compound Name | 1,3,5-trimethyl-2-methylsulfonylbenzene |
|---|---|
| PubChem CID | 577272 |
| Molecular Formula | C10H14O2S |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.07 |
| IUPAC Name | 1,3,5-trimethyl-2-methylsulfonylbenzene |
| SMILES | Cc1cc(C)c(S(C)(=O)=O)c(C)c1 |
| InChI | InChI=1S/C10H14O2S/c1-7-5-8(2)10(9(3)6-7)13(4,11)12/h5-6H,1-4H3 |
| InChIKey | VTSJEUVPFFSEBN-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |