C10H13ClO4S2 — CID 82276085
2,4,6-trimethyl-3-methylsulfonylbenzenesulfonyl chloride (PubChem CID 82276085) has the molecular formula C10H13ClO4S2 and a molecular weight of 296.80 g/mol. Its IUPAC name is 2,4,6-trimethyl-3-methylsulfonylbenzenesulfonyl chloride.
| Compound Name | 2,4,6-trimethyl-3-methylsulfonylbenzenesulfonyl chloride |
|---|---|
| PubChem CID | 82276085 |
| Molecular Formula | C10H13ClO4S2 |
| Molecular Weight | 296.80 g/mol |
| Exact Mass | 295.99 |
| IUPAC Name | 2,4,6-trimethyl-3-methylsulfonylbenzenesulfonyl chloride |
| SMILES | Cc1cc(C)c(S(=O)(=O)Cl)c(C)c1S(C)(=O)=O |
| InChI | InChI=1S/C10H13ClO4S2/c1-6-5-7(2)10(17(11,14)15)8(3)9(6)16(4,12)13/h5H,1-4H3 |
| InChIKey | HVNAUOVXAPZYIV-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.80 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |