2,4,6-trimethyl-3-methylsulfonylbenzenesulfonyl chloride

C10H13ClO4S2 — CID 82276085

IUPAC2,4,6-trimethyl-3-methylsulfonylbenzenesulfonyl chloride
SMILESCc1cc(C)c(S(=O)(=O)Cl)c(C)c1S(C)(=O)=O
InChIInChI=1S/C10H13ClO4S2/c1-6-5-7(2)10(17(11,14)15)8(3)9(6)16(4,12)13/h5H,1-4H3
InChIKeyHVNAUOVXAPZYIV-UHFFFAOYSA-N
MW296.80 g/mol
LogP1.94
Rot. Bonds2

About 2,4,6-trimethyl-3-methylsulfonylbenzenesulfonyl chloride

2,4,6-trimethyl-3-methylsulfonylbenzenesulfonyl chloride (PubChem CID 82276085) has the molecular formula C10H13ClO4S2 and a molecular weight of 296.80 g/mol. Its IUPAC name is 2,4,6-trimethyl-3-methylsulfonylbenzenesulfonyl chloride.

Molecular Properties

Compound Name2,4,6-trimethyl-3-methylsulfonylbenzenesulfonyl chloride
PubChem CID82276085
Molecular FormulaC10H13ClO4S2
Molecular Weight296.80 g/mol
Exact Mass295.99
IUPAC Name2,4,6-trimethyl-3-methylsulfonylbenzenesulfonyl chloride
SMILESCc1cc(C)c(S(=O)(=O)Cl)c(C)c1S(C)(=O)=O
InChIInChI=1S/C10H13ClO4S2/c1-6-5-7(2)10(17(11,14)15)8(3)9(6)16(4,12)13/h5H,1-4H3
InChIKeyHVNAUOVXAPZYIV-UHFFFAOYSA-N
XLogP1.94
TPSA68.28 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500296.80
LogP ≤ 51.94
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze 2,4,6-trimethyl-3-methylsulfonylbenzenesulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,4,6-trimethyl-3-methylsulfonylbenzenesulfonyl chloride?
The IUPAC name of 2,4,6-trimethyl-3-methylsulfonylbenzenesulfonyl chloride (CID 82276085) is 2,4,6-trimethyl-3-methylsulfonylbenzenesulfonyl chloride.
What is the SMILES notation for 2,4,6-trimethyl-3-methylsulfonylbenzenesulfonyl chloride?
The canonical SMILES for 2,4,6-trimethyl-3-methylsulfonylbenzenesulfonyl chloride is Cc1cc(C)c(S(=O)(=O)Cl)c(C)c1S(C)(=O)=O.
What is the InChIKey of 2,4,6-trimethyl-3-methylsulfonylbenzenesulfonyl chloride?
The InChIKey is HVNAUOVXAPZYIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13ClO4S2/c1-6-5-7(2)10(17(11,14)15)8(3)9(6)16(4,12)13/h5H,1-4H3.
What are the key properties of 2,4,6-trimethyl-3-methylsulfonylbenzenesulfonyl chloride?
2,4,6-trimethyl-3-methylsulfonylbenzenesulfonyl chloride has a molecular weight of 296.80 g/mol, XLogP of 1.94, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4,6-trimethyl-3-methylsulfonylbenzenesulfonyl chloride is sourced from PubChem (CID 82276085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).