C10H11ClO3S — CID 122216719
3-formyl-2,4,6-trimethylbenzenesulfonyl chloride (PubChem CID 122216719) has the molecular formula C10H11ClO3S and a molecular weight of 246.71 g/mol. Its IUPAC name is 3-formyl-2,4,6-trimethylbenzenesulfonyl chloride.
| Compound Name | 3-formyl-2,4,6-trimethylbenzenesulfonyl chloride |
|---|---|
| PubChem CID | 122216719 |
| Molecular Formula | C10H11ClO3S |
| Molecular Weight | 246.71 g/mol |
| Exact Mass | 246.01 |
| IUPAC Name | 3-formyl-2,4,6-trimethylbenzenesulfonyl chloride |
| SMILES | Cc1cc(C)c(S(=O)(=O)Cl)c(C)c1C=O |
| InChI | InChI=1S/C10H11ClO3S/c1-6-4-7(2)10(15(11,13)14)8(3)9(6)5-12/h4-5H,1-3H3 |
| InChIKey | QSWFIUHBBPKDJU-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.71 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|