C12H15ClFNO3S — CID 114267172
3-(2-fluoroethylcarbamoyl)-2,4,6-trimethylbenzenesulfonyl chloride (PubChem CID 114267172) has the molecular formula C12H15ClFNO3S and a molecular weight of 307.77 g/mol. Its IUPAC name is 3-(2-fluoroethylcarbamoyl)-2,4,6-trimethylbenzenesulfonyl chloride.
| Compound Name | 3-(2-fluoroethylcarbamoyl)-2,4,6-trimethylbenzenesulfonyl chloride |
|---|---|
| PubChem CID | 114267172 |
| Molecular Formula | C12H15ClFNO3S |
| Molecular Weight | 307.77 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | 3-(2-fluoroethylcarbamoyl)-2,4,6-trimethylbenzenesulfonyl chloride |
| SMILES | Cc1cc(C)c(S(=O)(=O)Cl)c(C)c1C(=O)NCCF |
| InChI | InChI=1S/C12H15ClFNO3S/c1-7-6-8(2)11(19(13,17)18)9(3)10(7)12(16)15-5-4-14/h6H,4-5H2,1-3H3,(H,15,16) |
| InChIKey | ZYNIBXHPDSWMAE-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.77 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |