C26H49N2P — CID 134932690
N-[diethylamino-(2,4,6-tritert-butylphenyl)phosphanyl]-2-methylpropan-2-amine (PubChem CID 134932690) has the molecular formula C26H49N2P and a molecular weight of 420.67 g/mol. Its IUPAC name is N-[diethylamino-(2,4,6-tritert-butylphenyl)phosphanyl]-2-methylpropan-2-amine.
| Compound Name | N-[diethylamino-(2,4,6-tritert-butylphenyl)phosphanyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 134932690 |
| Molecular Formula | C26H49N2P |
| Molecular Weight | 420.67 g/mol |
| Exact Mass | 420.36 |
| IUPAC Name | N-[diethylamino-(2,4,6-tritert-butylphenyl)phosphanyl]-2-methylpropan-2-amine |
| SMILES | CCN(CC)P(NC(C)(C)C)c1c(C(C)(C)C)cc(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C26H49N2P/c1-15-28(16-2)29(27-26(12,13)14)22-20(24(6,7)8)17-19(23(3,4)5)18-21(22)25(9,10)11/h17-18,27H,15-16H2,1-14H3 |
| InChIKey | RJHDEKSDKNDLBH-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.67 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|