C25H48NOPSi — CID 134932795
2-[butan-2-yloxy-(trimethylsilylamino)phosphanyl]-1,3,5-tritert-butylbenzene (PubChem CID 134932795) has the molecular formula C25H48NOPSi and a molecular weight of 437.73 g/mol. Its IUPAC name is 2-[butan-2-yloxy-(trimethylsilylamino)phosphanyl]-1,3,5-tritert-butylbenzene.
| Compound Name | 2-[butan-2-yloxy-(trimethylsilylamino)phosphanyl]-1,3,5-tritert-butylbenzene |
|---|---|
| PubChem CID | 134932795 |
| Molecular Formula | C25H48NOPSi |
| Molecular Weight | 437.73 g/mol |
| Exact Mass | 437.32 |
| IUPAC Name | 2-[butan-2-yloxy-(trimethylsilylamino)phosphanyl]-1,3,5-tritert-butylbenzene |
| SMILES | CCC(C)OP(N[Si](C)(C)C)c1c(C(C)(C)C)cc(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C25H48NOPSi/c1-15-18(2)27-28(26-29(12,13)14)22-20(24(6,7)8)16-19(23(3,4)5)17-21(22)25(9,10)11/h16-18,26H,15H2,1-14H3 |
| InChIKey | CWUZZGRKAMMZRO-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.73 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|