C27H49O4P — CID 67632840
[3-(hydroxymethyl)-5-methyl-4-(2,4,6-tritert-butylphenyl)heptan-4-yl] dihydrogen phosphite (PubChem CID 67632840) has the molecular formula C27H49O4P and a molecular weight of 468.66 g/mol. Its IUPAC name is [3-(hydroxymethyl)-5-methyl-4-(2,4,6-tritert-butylphenyl)heptan-4-yl] dihydrogen phosphite.
| Compound Name | [3-(hydroxymethyl)-5-methyl-4-(2,4,6-tritert-butylphenyl)heptan-4-yl] dihydrogen phosphite |
|---|---|
| PubChem CID | 67632840 |
| Molecular Formula | C27H49O4P |
| Molecular Weight | 468.66 g/mol |
| Exact Mass | 468.34 |
| IUPAC Name | [3-(hydroxymethyl)-5-methyl-4-(2,4,6-tritert-butylphenyl)heptan-4-yl] dihydrogen phosphite |
| SMILES | CCC(C)C(OP(O)O)(c1c(C(C)(C)C)cc(C(C)(C)C)cc1C(C)(C)C)C(CC)CO |
| InChI | InChI=1S/C27H49O4P/c1-13-18(3)27(31-32(29)30,19(14-2)17-28)23-21(25(7,8)9)15-20(24(4,5)6)16-22(23)26(10,11)12/h15-16,18-19,28-30H,13-14,17H2,1-12H3 |
| InChIKey | SEZWDNRJNIVGFC-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.66 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|