C28H31NOS — CID 161368656
5,6-ditert-butyl-7-(4-methoxyphenyl)-2-phenyl-1,3-benzothiazole (PubChem CID 161368656) has the molecular formula C28H31NOS and a molecular weight of 429.63 g/mol. Its IUPAC name is 5,6-ditert-butyl-7-(4-methoxyphenyl)-2-phenyl-1,3-benzothiazole.
| Compound Name | 5,6-ditert-butyl-7-(4-methoxyphenyl)-2-phenyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 161368656 |
| Molecular Formula | C28H31NOS |
| Molecular Weight | 429.63 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | 5,6-ditert-butyl-7-(4-methoxyphenyl)-2-phenyl-1,3-benzothiazole |
| SMILES | COc1ccc(-c2c(C(C)(C)C)c(C(C)(C)C)cc3nc(-c4ccccc4)sc23)cc1 |
| InChI | InChI=1S/C28H31NOS/c1-27(2,3)21-17-22-25(31-26(29-22)19-11-9-8-10-12-19)23(24(21)28(4,5)6)18-13-15-20(30-7)16-14-18/h8-17H,1-7H3 |
| InChIKey | YYVCPWMSXFQDOH-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.63 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |