C15H13NO2S — CID 101432733
6,7-dimethoxy-2-phenyl-1,3-benzothiazole (PubChem CID 101432733) has the molecular formula C15H13NO2S and a molecular weight of 271.34 g/mol. Its IUPAC name is 6,7-dimethoxy-2-phenyl-1,3-benzothiazole.
| Compound Name | 6,7-dimethoxy-2-phenyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 101432733 |
| Molecular Formula | C15H13NO2S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | 6,7-dimethoxy-2-phenyl-1,3-benzothiazole |
| SMILES | COc1ccc2nc(-c3ccccc3)sc2c1OC |
| InChI | InChI=1S/C15H13NO2S/c1-17-12-9-8-11-14(13(12)18-2)19-15(16-11)10-6-4-3-5-7-10/h3-9H,1-2H3 |
| InChIKey | KWZBCSOJOWGIMF-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |