C34H24F6O2 — CID 46189438
1,5-bis(4-methoxyphenyl)-2,3-diphenyl-4,6-bis(trifluoromethyl)benzene (PubChem CID 46189438) has the molecular formula C34H24F6O2 and a molecular weight of 578.55 g/mol. Its IUPAC name is 1,5-bis(4-methoxyphenyl)-2,3-diphenyl-4,6-bis(trifluoromethyl)benzene.
| Compound Name | 1,5-bis(4-methoxyphenyl)-2,3-diphenyl-4,6-bis(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 46189438 |
| Molecular Formula | C34H24F6O2 |
| Molecular Weight | 578.55 g/mol |
| Exact Mass | 578.17 |
| IUPAC Name | 1,5-bis(4-methoxyphenyl)-2,3-diphenyl-4,6-bis(trifluoromethyl)benzene |
| SMILES | COc1ccc(-c2c(-c3ccccc3)c(-c3ccccc3)c(C(F)(F)F)c(-c3ccc(OC)cc3)c2C(F)(F)F)cc1 |
| InChI | InChI=1S/C34H24F6O2/c1-41-25-17-13-23(14-18-25)29-27(21-9-5-3-6-10-21)28(22-11-7-4-8-12-22)31(33(35,36)37)30(32(29)34(38,39)40)24-15-19-26(42-2)20-16-24/h3-20H,1-2H3 |
| InChIKey | PFDGHTYQKMGNDL-UHFFFAOYSA-N |
| XLogP | 10.41 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.55 |
| LogP ≤ 5 | 10.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |