C46H38O4 — CID 102293642
1,4-bis(3,5-dimethoxyphenyl)-2,3,5,6-tetraphenylbenzene (PubChem CID 102293642) has the molecular formula C46H38O4 and a molecular weight of 654.81 g/mol. Its IUPAC name is 1,4-bis(3,5-dimethoxyphenyl)-2,3,5,6-tetraphenylbenzene.
| Compound Name | 1,4-bis(3,5-dimethoxyphenyl)-2,3,5,6-tetraphenylbenzene |
|---|---|
| PubChem CID | 102293642 |
| Molecular Formula | C46H38O4 |
| Molecular Weight | 654.81 g/mol |
| Exact Mass | 654.28 |
| IUPAC Name | 1,4-bis(3,5-dimethoxyphenyl)-2,3,5,6-tetraphenylbenzene |
| SMILES | COc1cc(OC)cc(-c2c(-c3ccccc3)c(-c3ccccc3)c(-c3cc(OC)cc(OC)c3)c(-c3ccccc3)c2-c2ccccc2)c1 |
| InChI | InChI=1S/C46H38O4/c1-47-37-25-35(26-38(29-37)48-2)45-41(31-17-9-5-10-18-31)43(33-21-13-7-14-22-33)46(36-27-39(49-3)30-40(28-36)50-4)44(34-23-15-8-16-24-34)42(45)32-19-11-6-12-20-32/h5-30H,1-4H3 |
| InChIKey | GFMMZILPPMWLNI-UHFFFAOYSA-N |
| XLogP | 11.72 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.81 |
| LogP ≤ 5 | 11.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |