C30H26O4 — CID 11961931
9,10-bis(3,5-dimethoxyphenyl)anthracene (PubChem CID 11961931) has the molecular formula C30H26O4 and a molecular weight of 450.53 g/mol. Its IUPAC name is 9,10-bis(3,5-dimethoxyphenyl)anthracene.
| Compound Name | 9,10-bis(3,5-dimethoxyphenyl)anthracene |
|---|---|
| PubChem CID | 11961931 |
| Molecular Formula | C30H26O4 |
| Molecular Weight | 450.53 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | 9,10-bis(3,5-dimethoxyphenyl)anthracene |
| SMILES | COc1cc(OC)cc(-c2c3ccccc3c(-c3cc(OC)cc(OC)c3)c3ccccc23)c1 |
| InChI | InChI=1S/C30H26O4/c1-31-21-13-19(14-22(17-21)32-2)29-25-9-5-7-11-27(25)30(28-12-8-6-10-26(28)29)20-15-23(33-3)18-24(16-20)34-4/h5-18H,1-4H3 |
| InChIKey | ANNLXUDHOREGON-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.53 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|