C14H14O2 — CID 11469945
1,3-dimethoxy-5-phenylbenzene (PubChem CID 11469945) has the molecular formula C14H14O2 and a molecular weight of 214.26 g/mol. Its IUPAC name is 1,3-dimethoxy-5-phenylbenzene.
| Compound Name | 1,3-dimethoxy-5-phenylbenzene |
|---|---|
| PubChem CID | 11469945 |
| Molecular Formula | C14H14O2 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | 1,3-dimethoxy-5-phenylbenzene |
| SMILES | COc1cc(OC)cc(-c2ccccc2)c1 |
| InChI | InChI=1S/C14H14O2/c1-15-13-8-12(9-14(10-13)16-2)11-6-4-3-5-7-11/h3-10H,1-2H3 |
| InChIKey | CQWCDYBZNSNECQ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |