C24H19OP — CID 102303596
2-(3-methoxyphenyl)-4,6-diphenylphosphinine (PubChem CID 102303596) has the molecular formula C24H19OP and a molecular weight of 354.39 g/mol. Its IUPAC name is 2-(3-methoxyphenyl)-4,6-diphenylphosphinine.
| Compound Name | 2-(3-methoxyphenyl)-4,6-diphenylphosphinine |
|---|---|
| PubChem CID | 102303596 |
| Molecular Formula | C24H19OP |
| Molecular Weight | 354.39 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 2-(3-methoxyphenyl)-4,6-diphenylphosphinine |
| SMILES | COc1cccc(-c2cc(-c3ccccc3)cc(-c3ccccc3)p2)c1 |
| InChI | InChI=1S/C24H19OP/c1-25-22-14-8-13-20(15-22)24-17-21(18-9-4-2-5-10-18)16-23(26-24)19-11-6-3-7-12-19/h2-17H,1H3 |
| InChIKey | RUSZNLQNPRJRAK-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.39 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |