C14H20ClF — CID 140644518
1,5-ditert-butyl-3-chloro-2-fluorobenzene (PubChem CID 140644518) has the molecular formula C14H20ClF and a molecular weight of 242.76 g/mol. Its IUPAC name is 1,5-ditert-butyl-3-chloro-2-fluorobenzene.
| Compound Name | 1,5-ditert-butyl-3-chloro-2-fluorobenzene |
|---|---|
| PubChem CID | 140644518 |
| Molecular Formula | C14H20ClF |
| Molecular Weight | 242.76 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 1,5-ditert-butyl-3-chloro-2-fluorobenzene |
| SMILES | CC(C)(C)c1cc(Cl)c(F)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C14H20ClF/c1-13(2,3)9-7-10(14(4,5)6)12(16)11(15)8-9/h7-8H,1-6H3 |
| InChIKey | ZRIWHLDIHWDWDN-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.76 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |