C16H29Cl — CID 161178339
1,4-ditert-butyl-2-chlorobenzene;methane (PubChem CID 161178339) has the molecular formula C16H29Cl and a molecular weight of 256.86 g/mol. Its IUPAC name is 1,4-ditert-butyl-2-chlorobenzene;methane.
| Compound Name | 1,4-ditert-butyl-2-chlorobenzene;methane |
|---|---|
| PubChem CID | 161178339 |
| Molecular Formula | C16H29Cl |
| Molecular Weight | 256.86 g/mol |
| Exact Mass | 256.20 |
| IUPAC Name | 1,4-ditert-butyl-2-chlorobenzene;methane |
| SMILES | C.C.CC(C)(C)c1ccc(C(C)(C)C)c(Cl)c1 |
| InChI | InChI=1S/C14H21Cl.2CH4/c1-13(2,3)10-7-8-11(12(15)9-10)14(4,5)6;;/h7-9H,1-6H3;2*1H4 |
| InChIKey | USCOPQZRGSTOHJ-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.86 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |