C9H9Cl2FO — CID 117318974
2-(3,5-dichloro-4-fluorophenyl)propan-2-ol (PubChem CID 117318974) has the molecular formula C9H9Cl2FO and a molecular weight of 223.07 g/mol. Its IUPAC name is 2-(3,5-dichloro-4-fluorophenyl)propan-2-ol.
| Compound Name | 2-(3,5-dichloro-4-fluorophenyl)propan-2-ol |
|---|---|
| PubChem CID | 117318974 |
| Molecular Formula | C9H9Cl2FO |
| Molecular Weight | 223.07 g/mol |
| Exact Mass | 222.00 |
| IUPAC Name | 2-(3,5-dichloro-4-fluorophenyl)propan-2-ol |
| SMILES | CC(C)(O)c1cc(Cl)c(F)c(Cl)c1 |
| InChI | InChI=1S/C9H9Cl2FO/c1-9(2,13)5-3-6(10)8(12)7(11)4-5/h3-4,13H,1-2H3 |
| InChIKey | IWVXCQWPXOGHLQ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.07 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|