C11H14Cl2O2 — CID 540635
2-[3,5-dichloro-4-(methoxymethyl)phenyl]propan-2-ol (PubChem CID 540635) has the molecular formula C11H14Cl2O2 and a molecular weight of 249.14 g/mol. Its IUPAC name is 2-[3,5-dichloro-4-(methoxymethyl)phenyl]propan-2-ol.
| Compound Name | 2-[3,5-dichloro-4-(methoxymethyl)phenyl]propan-2-ol |
|---|---|
| PubChem CID | 540635 |
| Molecular Formula | C11H14Cl2O2 |
| Molecular Weight | 249.14 g/mol |
| Exact Mass | 248.04 |
| IUPAC Name | 2-[3,5-dichloro-4-(methoxymethyl)phenyl]propan-2-ol |
| SMILES | COCc1c(Cl)cc(C(C)(C)O)cc1Cl |
| InChI | InChI=1S/C11H14Cl2O2/c1-11(2,14)7-4-9(12)8(6-15-3)10(13)5-7/h4-5,14H,6H2,1-3H3 |
| InChIKey | AFLWUSDXAJZZLQ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.14 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |