C9H9ClF2O2 — CID 117318845
[5-chloro-2,3-difluoro-4-(methoxymethyl)phenyl]methanol (PubChem CID 117318845) has the molecular formula C9H9ClF2O2 and a molecular weight of 222.62 g/mol. Its IUPAC name is [5-chloro-2,3-difluoro-4-(methoxymethyl)phenyl]methanol.
| Compound Name | [5-chloro-2,3-difluoro-4-(methoxymethyl)phenyl]methanol |
|---|---|
| PubChem CID | 117318845 |
| Molecular Formula | C9H9ClF2O2 |
| Molecular Weight | 222.62 g/mol |
| Exact Mass | 222.03 |
| IUPAC Name | [5-chloro-2,3-difluoro-4-(methoxymethyl)phenyl]methanol |
| SMILES | COCc1c(Cl)cc(CO)c(F)c1F |
| InChI | InChI=1S/C9H9ClF2O2/c1-14-4-6-7(10)2-5(3-13)8(11)9(6)12/h2,13H,3-4H2,1H3 |
| InChIKey | ZWQRSAJSWOAFSC-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.62 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|